About 2-amino-4-methoxyphenol
2-amino-4-methoxyphenol (PubChem CID 1419108) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 2-amino-4-methoxyphenol.
Molecular Properties
| Compound Name | 2-amino-4-methoxyphenol |
| PubChem CID | 1419108 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 2-amino-4-methoxyphenol |
| SMILES | COc1ccc(O)c(N)c1 |
| InChI | InChI=1S/C7H9NO2/c1-10-5-2-3-7(9)6(8)4-5/h2-4,9H,8H2,1H3 |
| InChIKey | TUADYTFWZPZZTP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methoxyphenol?
The IUPAC name of 2-amino-4-methoxyphenol (CID 1419108) is 2-amino-4-methoxyphenol.
What is the SMILES notation for 2-amino-4-methoxyphenol?
The canonical SMILES for 2-amino-4-methoxyphenol is COc1ccc(O)c(N)c1.
What is the InChIKey of 2-amino-4-methoxyphenol?
The InChIKey is TUADYTFWZPZZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-10-5-2-3-7(9)6(8)4-5/h2-4,9H,8H2,1H3.
What are the key properties of 2-amino-4-methoxyphenol?
2-amino-4-methoxyphenol has a molecular weight of 139.15 g/mol, XLogP of 0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methoxyphenol is sourced from PubChem (CID 1419108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).