About (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate
(4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate (PubChem CID 14191321) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate.
Molecular Properties
| Compound Name | (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate |
| PubChem CID | 14191321 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate |
| SMILES | CCC(=CCC(=O)OCCC(=O)C(CC)CC)CC |
| InChI | InChI=1S/C16H28O3/c1-5-13(6-2)9-10-16(18)19-12-11-15(17)14(7-3)8-4/h9,14H,5-8,10-12H2,1-4H3 |
| InChIKey | FPWHKDBDECIWEO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate?
The IUPAC name of (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate (CID 14191321) is (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate.
What is the SMILES notation for (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate?
The canonical SMILES for (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate is CCC(=CCC(=O)OCCC(=O)C(CC)CC)CC.
What is the InChIKey of (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate?
The InChIKey is FPWHKDBDECIWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-5-13(6-2)9-10-16(18)19-12-11-15(17)14(7-3)8-4/h9,14H,5-8,10-12H2,1-4H3.
What are the key properties of (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate?
(4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate has a molecular weight of 268.40 g/mol, XLogP of 4.06, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-3-oxohexyl) 4-ethylhex-3-enoate is sourced from PubChem (CID 14191321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).