C19H28O2 — CID 14191462
7-ethenyl-5-hydroxy-1,1,7-trimethyl-3,4,4a,5,6,8,10,10a-octahydro-2H-phenanthren-9-one (PubChem CID 14191462) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 7-ethenyl-5-hydroxy-1,1,7-trimethyl-3,4,4a,5,6,8,10,10a-octahydro-2H-phenanthren-9-one.
| Compound Name | 7-ethenyl-5-hydroxy-1,1,7-trimethyl-3,4,4a,5,6,8,10,10a-octahydro-2H-phenanthren-9-one |
|---|---|
| PubChem CID | 14191462 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 7-ethenyl-5-hydroxy-1,1,7-trimethyl-3,4,4a,5,6,8,10,10a-octahydro-2H-phenanthren-9-one |
| SMILES | C=CC1(C)CC2=C(C(O)C1)C1CCCC(C)(C)C1CC2=O |
| InChI | InChI=1S/C19H28O2/c1-5-19(4)10-13-15(20)9-14-12(17(13)16(21)11-19)7-6-8-18(14,2)3/h5,12,14,16,21H,1,6-11H2,2-4H3 |
| InChIKey | AIBBWOAHJMGWDA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|