About methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate
methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate (PubChem CID 14191876) has the molecular formula C22H40O5
and a molecular weight of 384.56 g/mol. Its IUPAC name is methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate.
Molecular Properties
| Compound Name | methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate |
| PubChem CID | 14191876 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate |
| SMILES | CCCCCC1OC(C)(C)OC1/C=C/C(O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C22H40O5/c1-5-6-10-14-19-20(27-22(2,3)26-19)17-16-18(23)13-11-8-7-9-12-15-21(24)25-4/h16-20,23H,5-15H2,1-4H3/b17-16+ |
| InChIKey | GNQYZJVASBFDMV-WUKNDPDISA-N |
| XLogP | 4.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate?
The IUPAC name of methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate (CID 14191876) is methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate.
What is the SMILES notation for methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate?
The canonical SMILES for methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate is CCCCCC1OC(C)(C)OC1/C=C/C(O)CCCCCCCC(=O)OC.
What is the InChIKey of methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate?
The InChIKey is GNQYZJVASBFDMV-WUKNDPDISA-N. The full InChI is InChI=1S/C22H40O5/c1-5-6-10-14-19-20(27-22(2,3)26-19)17-16-18(23)13-11-8-7-9-12-15-21(24)25-4/h16-20,23H,5-15H2,1-4H3/b17-16+.
What are the key properties of methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate?
methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate has a molecular weight of 384.56 g/mol, XLogP of 4.91, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-11-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)-9-hydroxyundec-10-enoate is sourced from PubChem (CID 14191876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).