C12H17NO — CID 141921295
(3Z,6E)-6-[(Z)-2-aminoethenyl]-2,5-dimethylideneocta-3,6-dien-1-ol (PubChem CID 141921295) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (3Z,6E)-6-[(Z)-2-aminoethenyl]-2,5-dimethylideneocta-3,6-dien-1-ol.
| Compound Name | (3Z,6E)-6-[(Z)-2-aminoethenyl]-2,5-dimethylideneocta-3,6-dien-1-ol |
|---|---|
| PubChem CID | 141921295 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (3Z,6E)-6-[(Z)-2-aminoethenyl]-2,5-dimethylideneocta-3,6-dien-1-ol |
| SMILES | C/C=C(\C=C/N)/C(=C)/C=C\C(=C)CO |
| InChI | InChI=1S/C12H17NO/c1-4-12(7-8-13)11(3)6-5-10(2)9-14/h4-8,14H,2-3,9,13H2,1H3/b6-5-,8-7-,12-4+ |
| InChIKey | CJJURBGALCJMFE-SZCXCFIISA-N |
| XLogP | 3.10 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | 295 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|