About [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate
[(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate (PubChem CID 14192533) has the molecular formula C19H26O4
and a molecular weight of 318.41 g/mol. Its IUPAC name is [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate.
Molecular Properties
| Compound Name | [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate |
| PubChem CID | 14192533 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)C#CC1=C(C)CC(OC(C)=O)CC1(C)C |
| InChI | InChI=1S/C19H26O4/c1-13(9-10-22-15(3)20)7-8-18-14(2)11-17(23-16(4)21)12-19(18,5)6/h9,17H,10-12H2,1-6H3/b13-9+ |
| InChIKey | VTWIPBUIGMOKBO-UKTHLTGXSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate?
The IUPAC name of [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate (CID 14192533) is [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate.
What is the SMILES notation for [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate?
The canonical SMILES for [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate is CC(=O)OC/C=C(\C)C#CC1=C(C)CC(OC(C)=O)CC1(C)C.
What is the InChIKey of [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate?
The InChIKey is VTWIPBUIGMOKBO-UKTHLTGXSA-N. The full InChI is InChI=1S/C19H26O4/c1-13(9-10-22-15(3)20)7-8-18-14(2)11-17(23-16(4)21)12-19(18,5)6/h9,17H,10-12H2,1-6H3/b13-9+.
What are the key properties of [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate?
[(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate has a molecular weight of 318.41 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-5-(4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3-methylpent-2-en-4-ynyl] acetate is sourced from PubChem (CID 14192533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).