C8H16O5 — CID 14194048
5-hydroxy-2,3,4-trimethoxypentanal (PubChem CID 14194048) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is 5-hydroxy-2,3,4-trimethoxypentanal.
| Compound Name | 5-hydroxy-2,3,4-trimethoxypentanal |
|---|---|
| PubChem CID | 14194048 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 5-hydroxy-2,3,4-trimethoxypentanal |
| SMILES | COC(C=O)C(OC)C(CO)OC |
| InChI | InChI=1S/C8H16O5/c1-11-6(4-9)8(13-3)7(5-10)12-2/h4,6-8,10H,5H2,1-3H3 |
| InChIKey | TZGIHUVVJVQDHY-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|