C22H22N6O3 — CID 1419485
2-(3,4-dimethoxyphenyl)-N'-[1-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]acetohydrazide (PubChem CID 1419485) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N'-[1-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]acetohydrazide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N'-[1-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 1419485 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N'-[1-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]acetohydrazide |
| SMILES | COc1ccc(CC(=O)NNc2ncnc3c2cnn3-c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C22H22N6O3/c1-14-4-7-16(8-5-14)28-22-17(12-25-28)21(23-13-24-22)27-26-20(29)11-15-6-9-18(30-2)19(10-15)31-3/h4-10,12-13H,11H2,1-3H3,(H,26,29)(H,23,24,27) |
| InChIKey | VHZMYBKHBSHJRV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|