C15H21NOS — CID 14195132
(4aR,10bR)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzothiazin-7-ol (PubChem CID 14195132) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is (4aR,10bR)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzothiazin-7-ol.
| Compound Name | (4aR,10bR)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzothiazin-7-ol |
|---|---|
| PubChem CID | 14195132 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (4aR,10bR)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzothiazin-7-ol |
| SMILES | CCCN1CCS[C@@H]2c3cccc(O)c3CC[C@H]21 |
| InChI | InChI=1S/C15H21NOS/c1-2-8-16-9-10-18-15-12-4-3-5-14(17)11(12)6-7-13(15)16/h3-5,13,15,17H,2,6-10H2,1H3/t13-,15-/m1/s1 |
| InChIKey | JWFGWJVDKLSYIE-UKRRQHHQSA-N |
| XLogP | 3.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |