C23H29N5+2 — CID 1419514
(3R,13R)-4,8,12-trimethyl-3,13-dipyridin-3-yl-8-aza-4,12-diazoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene (PubChem CID 1419514) has the molecular formula C23H29N5+2 and a molecular weight of 375.52 g/mol. Its IUPAC name is (3R,13R)-4,8,12-trimethyl-3,13-dipyridin-3-yl-8-aza-4,12-diazoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene.
| Compound Name | (3R,13R)-4,8,12-trimethyl-3,13-dipyridin-3-yl-8-aza-4,12-diazoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene |
|---|---|
| PubChem CID | 1419514 |
| Molecular Formula | C23H29N5+2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (3R,13R)-4,8,12-trimethyl-3,13-dipyridin-3-yl-8-aza-4,12-diazoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene |
| SMILES | Cn1c2c(c3c1CC[NH+](C)[C@@H]3c1cccnc1)[C@@H](c1cccnc1)[NH+](C)CC2 |
| InChI | InChI=1S/C23H27N5/c1-26-12-8-18-20(22(26)16-6-4-10-24-14-16)21-19(28(18)3)9-13-27(2)23(21)17-7-5-11-25-15-17/h4-7,10-11,14-15,22-23H,8-9,12-13H2,1-3H3/p+2/t22-,23-/m1/s1 |
| InChIKey | PDDZIKHNUPMLDS-DHIUTWEWSA-P |
| XLogP | 0.14 |
| TPSA | 39.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |