About 4,5-dichlorobenzene-1,3-disulfonyl chloride
4,5-dichlorobenzene-1,3-disulfonyl chloride (PubChem CID 14195249) has the molecular formula C6H2Cl4O4S2
and a molecular weight of 344.02 g/mol. Its IUPAC name is 4,5-dichlorobenzene-1,3-disulfonyl chloride.
Molecular Properties
| Compound Name | 4,5-dichlorobenzene-1,3-disulfonyl chloride |
| PubChem CID | 14195249 |
| Molecular Formula | C6H2Cl4O4S2 |
| Molecular Weight | 344.02 g/mol |
| Exact Mass | 341.81 |
| IUPAC Name | 4,5-dichlorobenzene-1,3-disulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(Cl)c(Cl)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C6H2Cl4O4S2/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14/h1-2H |
| InChIKey | DELKNGSNILXDSN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.02 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dichlorobenzene-1,3-disulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichlorobenzene-1,3-disulfonyl chloride?
The IUPAC name of 4,5-dichlorobenzene-1,3-disulfonyl chloride (CID 14195249) is 4,5-dichlorobenzene-1,3-disulfonyl chloride.
What is the SMILES notation for 4,5-dichlorobenzene-1,3-disulfonyl chloride?
The canonical SMILES for 4,5-dichlorobenzene-1,3-disulfonyl chloride is O=S(=O)(Cl)c1cc(Cl)c(Cl)c(S(=O)(=O)Cl)c1.
What is the InChIKey of 4,5-dichlorobenzene-1,3-disulfonyl chloride?
The InChIKey is DELKNGSNILXDSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl4O4S2/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14/h1-2H.
What are the key properties of 4,5-dichlorobenzene-1,3-disulfonyl chloride?
4,5-dichlorobenzene-1,3-disulfonyl chloride has a molecular weight of 344.02 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichlorobenzene-1,3-disulfonyl chloride is sourced from PubChem (CID 14195249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).