benzene-1,2-disulfonyl fluoride

C6H4F2O4S2 — CID 14195259

IUPACbenzene-1,2-disulfonyl fluoride
SMILESO=S(=O)(F)c1ccccc1S(=O)(=O)F
InChIInChI=1S/C6H4F2O4S2/c7-13(9,10)5-3-1-2-4-6(5)14(8,11)12/h1-4H
InChIKeyDNXLZBKMVRTNHQ-UHFFFAOYSA-N
MW242.22 g/mol
LogP1.00
Rot. Bonds2

About benzene-1,2-disulfonyl fluoride

benzene-1,2-disulfonyl fluoride (PubChem CID 14195259) has the molecular formula C6H4F2O4S2 and a molecular weight of 242.22 g/mol. Its IUPAC name is benzene-1,2-disulfonyl fluoride.

Molecular Properties

Compound Namebenzene-1,2-disulfonyl fluoride
PubChem CID14195259
Molecular FormulaC6H4F2O4S2
Molecular Weight242.22 g/mol
Exact Mass241.95
IUPAC Namebenzene-1,2-disulfonyl fluoride
SMILESO=S(=O)(F)c1ccccc1S(=O)(=O)F
InChIInChI=1S/C6H4F2O4S2/c7-13(9,10)5-3-1-2-4-6(5)14(8,11)12/h1-4H
InChIKeyDNXLZBKMVRTNHQ-UHFFFAOYSA-N
XLogP1.00
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.22
LogP ≤ 51.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzene-1,2-disulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzene-1,2-disulfonyl fluoride?
The IUPAC name of benzene-1,2-disulfonyl fluoride (CID 14195259) is benzene-1,2-disulfonyl fluoride.
What is the SMILES notation for benzene-1,2-disulfonyl fluoride?
The canonical SMILES for benzene-1,2-disulfonyl fluoride is O=S(=O)(F)c1ccccc1S(=O)(=O)F.
What is the InChIKey of benzene-1,2-disulfonyl fluoride?
The InChIKey is DNXLZBKMVRTNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2O4S2/c7-13(9,10)5-3-1-2-4-6(5)14(8,11)12/h1-4H.
What are the key properties of benzene-1,2-disulfonyl fluoride?
benzene-1,2-disulfonyl fluoride has a molecular weight of 242.22 g/mol, XLogP of 1.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-disulfonyl fluoride is sourced from PubChem (CID 14195259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).