About 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione
2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione (PubChem CID 14195304) has the molecular formula C5H5N3S2
and a molecular weight of 171.25 g/mol. Its IUPAC name is 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione.
Molecular Properties
| Compound Name | 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione |
| PubChem CID | 14195304 |
| Molecular Formula | C5H5N3S2 |
| Molecular Weight | 171.25 g/mol |
| Exact Mass | 170.99 |
| IUPAC Name | 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione |
| SMILES | Cn1sc2nccn2c1=S |
| InChI | InChI=1S/C5H5N3S2/c1-7-5(9)8-3-2-6-4(8)10-7/h2-3H,1H3 |
| InChIKey | VWRSYUWDGBSIHO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione?
The IUPAC name of 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione (CID 14195304) is 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione.
What is the SMILES notation for 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione?
The canonical SMILES for 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione is Cn1sc2nccn2c1=S.
What is the InChIKey of 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione?
The InChIKey is VWRSYUWDGBSIHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3S2/c1-7-5(9)8-3-2-6-4(8)10-7/h2-3H,1H3.
What are the key properties of 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione?
2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione has a molecular weight of 171.25 g/mol, XLogP of 1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazo[1,2-d][1,2,4]thiadiazole-3-thione is sourced from PubChem (CID 14195304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).