C9H23NSi2 — CID 14195381
1-ethyl-2,2,6,6-tetramethyl-1,2,6-azadisilinane (PubChem CID 14195381) has the molecular formula C9H23NSi2 and a molecular weight of 201.46 g/mol. Its IUPAC name is 1-ethyl-2,2,6,6-tetramethyl-1,2,6-azadisilinane.
| Compound Name | 1-ethyl-2,2,6,6-tetramethyl-1,2,6-azadisilinane |
|---|---|
| PubChem CID | 14195381 |
| Molecular Formula | C9H23NSi2 |
| Molecular Weight | 201.46 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 1-ethyl-2,2,6,6-tetramethyl-1,2,6-azadisilinane |
| SMILES | CCN1[Si](C)(C)CCC[Si]1(C)C |
| InChI | InChI=1S/C9H23NSi2/c1-6-10-11(2,3)8-7-9-12(10,4)5/h6-9H2,1-5H3 |
| InChIKey | WIXJPVASNJQNDE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|