C10H25NSi2 — CID 14195382
2,2,6,6-tetramethyl-1-propyl-1,2,6-azadisilinane (PubChem CID 14195382) has the molecular formula C10H25NSi2 and a molecular weight of 215.49 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-propyl-1,2,6-azadisilinane.
| Compound Name | 2,2,6,6-tetramethyl-1-propyl-1,2,6-azadisilinane |
|---|---|
| PubChem CID | 14195382 |
| Molecular Formula | C10H25NSi2 |
| Molecular Weight | 215.49 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-propyl-1,2,6-azadisilinane |
| SMILES | CCCN1[Si](C)(C)CCC[Si]1(C)C |
| InChI | InChI=1S/C10H25NSi2/c1-6-8-11-12(2,3)9-7-10-13(11,4)5/h6-10H2,1-5H3 |
| InChIKey | HKEZIKHMMUJDIJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|