About 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol
3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol (PubChem CID 14195692) has the molecular formula C20H42O
and a molecular weight of 298.56 g/mol. Its IUPAC name is 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol.
Molecular Properties
| Compound Name | 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol |
| PubChem CID | 14195692 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol |
| SMILES | CCCC(CCC)(CCC)CC(O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H42O/c1-10-13-19(14-11-2,15-12-3)16-20(21,17(4,5)6)18(7,8)9/h21H,10-16H2,1-9H3 |
| InChIKey | GGXHOYPGUIZPLZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol?
The IUPAC name of 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol (CID 14195692) is 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol.
What is the SMILES notation for 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol?
The canonical SMILES for 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol is CCCC(CCC)(CCC)CC(O)(C(C)(C)C)C(C)(C)C.
What is the InChIKey of 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol?
The InChIKey is GGXHOYPGUIZPLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O/c1-10-13-19(14-11-2,15-12-3)16-20(21,17(4,5)6)18(7,8)9/h21H,10-16H2,1-9H3.
What are the key properties of 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol?
3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol has a molecular weight of 298.56 g/mol, XLogP of 6.59, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2,2-dimethyl-5,5-dipropyloctan-3-ol is sourced from PubChem (CID 14195692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).