About 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol
3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol (PubChem CID 14195693) has the molecular formula C22H46O
and a molecular weight of 326.61 g/mol. Its IUPAC name is 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol.
Molecular Properties
| Compound Name | 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol |
| PubChem CID | 14195693 |
| Molecular Formula | C22H46O |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.35 |
| IUPAC Name | 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol |
| SMILES | CCCCCC(CCC)(CCC)CC(O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H46O/c1-10-13-14-17-21(15-11-2,16-12-3)18-22(23,19(4,5)6)20(7,8)9/h23H,10-18H2,1-9H3 |
| InChIKey | BNEQAVNMIKOOGK-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol?
The IUPAC name of 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol (CID 14195693) is 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol.
What is the SMILES notation for 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol?
The canonical SMILES for 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol is CCCCCC(CCC)(CCC)CC(O)(C(C)(C)C)C(C)(C)C.
What is the InChIKey of 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol?
The InChIKey is BNEQAVNMIKOOGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46O/c1-10-13-14-17-21(15-11-2,16-12-3)18-22(23,19(4,5)6)20(7,8)9/h23H,10-18H2,1-9H3.
What are the key properties of 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol?
3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol has a molecular weight of 326.61 g/mol, XLogP of 7.37, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2,2-dimethyl-5,5-dipropyldecan-3-ol is sourced from PubChem (CID 14195693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).