About 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol
3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol (PubChem CID 14195695) has the molecular formula C25H52O
and a molecular weight of 368.69 g/mol. Its IUPAC name is 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol.
Molecular Properties
| Compound Name | 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol |
| PubChem CID | 14195695 |
| Molecular Formula | C25H52O |
| Molecular Weight | 368.69 g/mol |
| Exact Mass | 368.40 |
| IUPAC Name | 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol |
| SMILES | CCCCCCCCC(CC)(CCCC)CC(O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C25H52O/c1-10-13-15-16-17-18-20-24(12-3,19-14-11-2)21-25(26,22(4,5)6)23(7,8)9/h26H,10-21H2,1-9H3 |
| InChIKey | FPKZKQCYXYXINV-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.69 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol?
The IUPAC name of 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol (CID 14195695) is 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol.
What is the SMILES notation for 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol?
The canonical SMILES for 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol is CCCCCCCCC(CC)(CCCC)CC(O)(C(C)(C)C)C(C)(C)C.
What is the InChIKey of 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol?
The InChIKey is FPKZKQCYXYXINV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H52O/c1-10-13-15-16-17-18-20-24(12-3,19-14-11-2)21-25(26,22(4,5)6)23(7,8)9/h26H,10-21H2,1-9H3.
What are the key properties of 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol?
3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol has a molecular weight of 368.69 g/mol, XLogP of 8.54, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol is sourced from PubChem (CID 14195695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).