About (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane
(5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane (PubChem CID 14195731) has the molecular formula C20H40
and a molecular weight of 280.54 g/mol. Its IUPAC name is (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane.
Molecular Properties
| Compound Name | (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane |
| PubChem CID | 14195731 |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 280.31 |
| IUPAC Name | (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane |
| SMILES | CCCCCC(CC)(CC)/C(=C/C(C)(C)C)CCCC |
| InChI | InChI=1S/C20H40/c1-8-12-14-16-20(10-3,11-4)18(15-13-9-2)17-19(5,6)7/h17H,8-16H2,1-7H3/b18-17+ |
| InChIKey | FLNNYYNRWLKYML-ISLYRVAYSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane?
The IUPAC name of (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane (CID 14195731) is (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane.
What is the SMILES notation for (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane?
The canonical SMILES for (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane is CCCCCC(CC)(CC)/C(=C/C(C)(C)C)CCCC.
What is the InChIKey of (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane?
The InChIKey is FLNNYYNRWLKYML-ISLYRVAYSA-N. The full InChI is InChI=1S/C20H40/c1-8-12-14-16-20(10-3,11-4)18(15-13-9-2)17-19(5,6)7/h17H,8-16H2,1-7H3/b18-17+.
What are the key properties of (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane?
(5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane has a molecular weight of 280.54 g/mol, XLogP of 7.54, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-(2,2-dimethylpropylidene)-6,6-diethylundecane is sourced from PubChem (CID 14195731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).