C22H44 — CID 14195732
(E)-2,2-dimethyl-4,5,5-tripropylundec-3-ene (PubChem CID 14195732) has the molecular formula C22H44 and a molecular weight of 308.59 g/mol. Its IUPAC name is (E)-2,2-dimethyl-4,5,5-tripropylundec-3-ene.
| Compound Name | (E)-2,2-dimethyl-4,5,5-tripropylundec-3-ene |
|---|---|
| PubChem CID | 14195732 |
| Molecular Formula | C22H44 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 308.34 |
| IUPAC Name | (E)-2,2-dimethyl-4,5,5-tripropylundec-3-ene |
| SMILES | CCCCCCC(CCC)(CCC)/C(=C/C(C)(C)C)CCC |
| InChI | InChI=1S/C22H44/c1-8-12-13-14-18-22(16-10-3,17-11-4)20(15-9-2)19-21(5,6)7/h19H,8-18H2,1-7H3/b20-19+ |
| InChIKey | JVPJKFFAELTIJM-FMQUCBEESA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|