C17H18O — CID 14195926
3-(3-phenylpropyl)-2,3-dihydro-1-benzofuran (PubChem CID 14195926) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-(3-phenylpropyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 3-(3-phenylpropyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 14195926 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 3-(3-phenylpropyl)-2,3-dihydro-1-benzofuran |
| SMILES | c1ccc(CCCC2COc3ccccc32)cc1 |
| InChI | InChI=1S/C17H18O/c1-2-7-14(8-3-1)9-6-10-15-13-18-17-12-5-4-11-16(15)17/h1-5,7-8,11-12,15H,6,9-10,13H2 |
| InChIKey | UVVPTECRDHVPDF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |