C35H47NO3 — CID 14196119
tert-butyl 1,7,8-tritert-butyl-3,5-diphenyl-2-oxa-4-azabicyclo[4.2.0]octa-3,7-diene-6-carboxylate (PubChem CID 14196119) has the molecular formula C35H47NO3 and a molecular weight of 529.77 g/mol. Its IUPAC name is tert-butyl 1,7,8-tritert-butyl-3,5-diphenyl-2-oxa-4-azabicyclo[4.2.0]octa-3,7-diene-6-carboxylate.
| Compound Name | tert-butyl 1,7,8-tritert-butyl-3,5-diphenyl-2-oxa-4-azabicyclo[4.2.0]octa-3,7-diene-6-carboxylate |
|---|---|
| PubChem CID | 14196119 |
| Molecular Formula | C35H47NO3 |
| Molecular Weight | 529.77 g/mol |
| Exact Mass | 529.36 |
| IUPAC Name | tert-butyl 1,7,8-tritert-butyl-3,5-diphenyl-2-oxa-4-azabicyclo[4.2.0]octa-3,7-diene-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)C12C(C(C)(C)C)=C(C(C)(C)C)C1(C(C)(C)C)OC(c1ccccc1)=NC2c1ccccc1 |
| InChI | InChI=1S/C35H47NO3/c1-30(2,3)25-26(31(4,5)6)35(32(7,8)9)34(25,29(37)39-33(10,11)12)27(23-19-15-13-16-20-23)36-28(38-35)24-21-17-14-18-22-24/h13-22,27H,1-12H3 |
| InChIKey | HDLQSSYZGARUMN-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.77 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|