C12H22O3 — CID 14196163
3-tert-butyl-3-(3,3-dimethylbut-1-en-2-yl)-1,2,4-trioxolane (PubChem CID 14196163) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 3-tert-butyl-3-(3,3-dimethylbut-1-en-2-yl)-1,2,4-trioxolane.
| Compound Name | 3-tert-butyl-3-(3,3-dimethylbut-1-en-2-yl)-1,2,4-trioxolane |
|---|---|
| PubChem CID | 14196163 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 3-tert-butyl-3-(3,3-dimethylbut-1-en-2-yl)-1,2,4-trioxolane |
| SMILES | C=C(C(C)(C)C)C1(C(C)(C)C)OCOO1 |
| InChI | InChI=1S/C12H22O3/c1-9(10(2,3)4)12(11(5,6)7)13-8-14-15-12/h1,8H2,2-7H3 |
| InChIKey | UDBTXLREISHHNA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|