C16H22O6S — CID 14196359
ethyl (E)-4,4-dimethoxy-2-(4-methylphenyl)sulfonylpent-2-enoate (PubChem CID 14196359) has the molecular formula C16H22O6S and a molecular weight of 342.41 g/mol. Its IUPAC name is ethyl (E)-4,4-dimethoxy-2-(4-methylphenyl)sulfonylpent-2-enoate.
| Compound Name | ethyl (E)-4,4-dimethoxy-2-(4-methylphenyl)sulfonylpent-2-enoate |
|---|---|
| PubChem CID | 14196359 |
| Molecular Formula | C16H22O6S |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | ethyl (E)-4,4-dimethoxy-2-(4-methylphenyl)sulfonylpent-2-enoate |
| SMILES | CCOC(=O)/C(=C\C(C)(OC)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O6S/c1-6-22-15(17)14(11-16(3,20-4)21-5)23(18,19)13-9-7-12(2)8-10-13/h7-11H,6H2,1-5H3/b14-11+ |
| InChIKey | VAOZKWQXTCJUHW-SDNWHVSQSA-N |
| XLogP | 2.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|