C18H14ClN3 — CID 14196436
20-methyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene;hydrochloride (PubChem CID 14196436) has the molecular formula C18H14ClN3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 20-methyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene;hydrochloride.
| Compound Name | 20-methyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene;hydrochloride |
|---|---|
| PubChem CID | 14196436 |
| Molecular Formula | C18H14ClN3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 20-methyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene;hydrochloride |
| SMILES | Cl.Cn1c2ccccc2c2ncc3[nH]c4ccccc4c3c21 |
| InChI | InChI=1S/C18H13N3.ClH/c1-21-15-9-5-3-7-12(15)17-18(21)16-11-6-2-4-8-13(11)20-14(16)10-19-17;/h2-10,20H,1H3;1H |
| InChIKey | WHPXGMZBDAPAIB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |