About N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine
N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine (PubChem CID 14196964) has the molecular formula C15H18N2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine.
Molecular Properties
| Compound Name | N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine |
| PubChem CID | 14196964 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine |
| SMILES | C=C=CCN(C)Cc1cc2ccccc2n1C |
| InChI | InChI=1S/C15H18N2/c1-4-5-10-16(2)12-14-11-13-8-6-7-9-15(13)17(14)3/h5-9,11H,1,10,12H2,2-3H3 |
| InChIKey | WERYIEFXGPEHII-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine?
The IUPAC name of N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine (CID 14196964) is N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine.
What is the SMILES notation for N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine?
The canonical SMILES for N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine is C=C=CCN(C)Cc1cc2ccccc2n1C.
What is the InChIKey of N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine?
The InChIKey is WERYIEFXGPEHII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2/c1-4-5-10-16(2)12-14-11-13-8-6-7-9-15(13)17(14)3/h5-9,11H,1,10,12H2,2-3H3.
What are the key properties of N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine?
N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine has a molecular weight of 226.32 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(1-methylindol-2-yl)methyl]buta-2,3-dien-1-amine is sourced from PubChem (CID 14196964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).