C15H21ClN2O — CID 14197121
2-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)amino]ethanol;hydrochloride (PubChem CID 14197121) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)amino]ethanol;hydrochloride.
| Compound Name | 2-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)amino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 14197121 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)amino]ethanol;hydrochloride |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCCC3NCCO.Cl |
| InChI | InChI=1S/C15H20N2O.ClH/c1-10-5-6-13-12(9-10)11-3-2-4-14(15(11)17-13)16-7-8-18;/h5-6,9,14,16-18H,2-4,7-8H2,1H3;1H |
| InChIKey | NWYSYCDJBCLXBS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|