About 2-propan-2-ylthiirane
2-propan-2-ylthiirane (PubChem CID 14197234) has the molecular formula C5H10S
and a molecular weight of 102.20 g/mol. Its IUPAC name is 2-propan-2-ylthiirane.
Molecular Properties
| Compound Name | 2-propan-2-ylthiirane |
| PubChem CID | 14197234 |
| Molecular Formula | C5H10S |
| Molecular Weight | 102.20 g/mol |
| Exact Mass | 102.05 |
| IUPAC Name | 2-propan-2-ylthiirane |
| SMILES | CC(C)C1CS1 |
| InChI | InChI=1S/C5H10S/c1-4(2)5-3-6-5/h4-5H,3H2,1-2H3 |
| InChIKey | KJCWDNAAEQCJMY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-ylthiirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylthiirane?
The IUPAC name of 2-propan-2-ylthiirane (CID 14197234) is 2-propan-2-ylthiirane.
What is the SMILES notation for 2-propan-2-ylthiirane?
The canonical SMILES for 2-propan-2-ylthiirane is CC(C)C1CS1.
What is the InChIKey of 2-propan-2-ylthiirane?
The InChIKey is KJCWDNAAEQCJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10S/c1-4(2)5-3-6-5/h4-5H,3H2,1-2H3.
What are the key properties of 2-propan-2-ylthiirane?
2-propan-2-ylthiirane has a molecular weight of 102.20 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylthiirane is sourced from PubChem (CID 14197234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).