About 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole
2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 14197394) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| PubChem CID | 14197394 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCCCc1c(C)cccc1C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C16H23NO/c1-5-6-9-13-12(2)8-7-10-14(13)15-17-16(3,4)11-18-15/h7-8,10H,5-6,9,11H2,1-4H3 |
| InChIKey | CFVZDKHEGHQFEM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole?
The IUPAC name of 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole (CID 14197394) is 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole.
What is the SMILES notation for 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole?
The canonical SMILES for 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole is CCCCc1c(C)cccc1C1=NC(C)(C)CO1.
What is the InChIKey of 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole?
The InChIKey is CFVZDKHEGHQFEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-5-6-9-13-12(2)8-7-10-14(13)15-17-16(3,4)11-18-15/h7-8,10H,5-6,9,11H2,1-4H3.
What are the key properties of 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole?
2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole has a molecular weight of 245.37 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butyl-3-methylphenyl)-4,4-dimethyl-5H-1,3-oxazole is sourced from PubChem (CID 14197394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).