C5H9ClF4OSi — CID 14197918
chloro-dimethyl-(2,2,3,3-tetrafluoropropoxy)silane (PubChem CID 14197918) has the molecular formula C5H9ClF4OSi and a molecular weight of 224.66 g/mol. Its IUPAC name is chloro-dimethyl-(2,2,3,3-tetrafluoropropoxy)silane.
| Compound Name | chloro-dimethyl-(2,2,3,3-tetrafluoropropoxy)silane |
|---|---|
| PubChem CID | 14197918 |
| Molecular Formula | C5H9ClF4OSi |
| Molecular Weight | 224.66 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | chloro-dimethyl-(2,2,3,3-tetrafluoropropoxy)silane |
| SMILES | C[Si](C)(Cl)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C5H9ClF4OSi/c1-12(2,6)11-3-5(9,10)4(7)8/h4H,3H2,1-2H3 |
| InChIKey | FMQBQFBJQZNXEU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.66 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|