C14H28O4S2 — CID 14198005
2-(3,3-dimethoxybutan-2-yl)-2-(2,2-dimethoxyethyl)-1,3-dithiane (PubChem CID 14198005) has the molecular formula C14H28O4S2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-(3,3-dimethoxybutan-2-yl)-2-(2,2-dimethoxyethyl)-1,3-dithiane.
| Compound Name | 2-(3,3-dimethoxybutan-2-yl)-2-(2,2-dimethoxyethyl)-1,3-dithiane |
|---|---|
| PubChem CID | 14198005 |
| Molecular Formula | C14H28O4S2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-(3,3-dimethoxybutan-2-yl)-2-(2,2-dimethoxyethyl)-1,3-dithiane |
| SMILES | COC(CC1(C(C)C(C)(OC)OC)SCCCS1)OC |
| InChI | InChI=1S/C14H28O4S2/c1-11(13(2,17-5)18-6)14(10-12(15-3)16-4)19-8-7-9-20-14/h11-12H,7-10H2,1-6H3 |
| InChIKey | CTBDPKHSSRZYNR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|