C22H24ClFN2O2 — CID 14198563
4-[4-(1-benzofuran-7-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride (PubChem CID 14198563) has the molecular formula C22H24ClFN2O2 and a molecular weight of 402.90 g/mol. Its IUPAC name is 4-[4-(1-benzofuran-7-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride.
| Compound Name | 4-[4-(1-benzofuran-7-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 14198563 |
| Molecular Formula | C22H24ClFN2O2 |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 4-[4-(1-benzofuran-7-yl)piperazin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCCN1CCN(c2cccc3ccoc23)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN2O2.ClH/c23-19-8-6-17(7-9-19)21(26)5-2-11-24-12-14-25(15-13-24)20-4-1-3-18-10-16-27-22(18)20;/h1,3-4,6-10,16H,2,5,11-15H2;1H |
| InChIKey | XCQYMLNLHMTUBD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |