About barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate)
barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate) (PubChem CID 14199) has the molecular formula C40H26BaN4O8S2
and a molecular weight of 892.13 g/mol. Its IUPAC name is barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate).
Molecular Properties
| Compound Name | barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate) |
| PubChem CID | 14199 |
| Molecular Formula | C40H26BaN4O8S2 |
| Molecular Weight | 892.13 g/mol |
| Exact Mass | 892.02 |
| IUPAC Name | barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate) |
| SMILES | O=S(=O)([O-])c1c(/N=N/c2c(O)ccc3ccccc23)ccc2ccccc12.O=S(=O)([O-])c1c(/N=N/c2c(O)ccc3ccccc23)ccc2ccccc12.[Ba+2] |
| InChI | InChI=1S/2C20H14N2O4S.Ba/c2*23-18-12-10-13-5-1-3-7-15(13)19(18)22-21-17-11-9-14-6-2-4-8-16(14)20(17)27(24,25)26;/h2*1-12,23H,(H,24,25,26);/q;;+2/p-2/b2*22-21+; |
| InChIKey | LFZDEAVRTJKYAF-JTVZJQPRSA-L |
| XLogP | 9.66 |
| TPSA | 204.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 892.13 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate)?
The IUPAC name of barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate) (CID 14199) is barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate).
What is the SMILES notation for barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate)?
The canonical SMILES for barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate) is O=S(=O)([O-])c1c(/N=N/c2c(O)ccc3ccccc23)ccc2ccccc12.O=S(=O)([O-])c1c(/N=N/c2c(O)ccc3ccccc23)ccc2ccccc12.[Ba+2].
What is the InChIKey of barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate)?
The InChIKey is LFZDEAVRTJKYAF-JTVZJQPRSA-L. The full InChI is InChI=1S/2C20H14N2O4S.Ba/c2*23-18-12-10-13-5-1-3-7-15(13)19(18)22-21-17-11-9-14-6-2-4-8-16(14)20(17)27(24,25)26;/h2*1-12,23H,(H,24,25,26);/q;;+2/p-2/b2*22-21+;.
What are the key properties of barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate)?
barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate) has a molecular weight of 892.13 g/mol, XLogP of 9.66, 6 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate) is sourced from PubChem (CID 14199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).