About 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine
2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine (PubChem CID 14199094) has the molecular formula C11H14BrNO3
and a molecular weight of 288.14 g/mol. Its IUPAC name is 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine |
| PubChem CID | 14199094 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine |
| SMILES | CCOC1(OCC)c2cnccc2OC1Br |
| InChI | InChI=1S/C11H14BrNO3/c1-3-14-11(15-4-2)8-7-13-6-5-9(8)16-10(11)12/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | FCWUASHOGSYGKG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine?
The IUPAC name of 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine (CID 14199094) is 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine.
What is the SMILES notation for 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine?
The canonical SMILES for 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine is CCOC1(OCC)c2cnccc2OC1Br.
What is the InChIKey of 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine?
The InChIKey is FCWUASHOGSYGKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrNO3/c1-3-14-11(15-4-2)8-7-13-6-5-9(8)16-10(11)12/h5-7,10H,3-4H2,1-2H3.
What are the key properties of 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine?
2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine has a molecular weight of 288.14 g/mol, XLogP of 2.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,3-diethoxy-2H-furo[3,2-c]pyridine is sourced from PubChem (CID 14199094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).