C20H17ClN2O6 — CID 1419974
1-(4-chlorophenyl)-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1419974) has the molecular formula C20H17ClN2O6 and a molecular weight of 416.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-chlorophenyl)-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1419974 |
| Molecular Formula | C20H17ClN2O6 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(C=C2C(=O)NC(=O)N(c3ccc(Cl)cc3)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C20H17ClN2O6/c1-27-15-9-4-11(16(28-2)17(15)29-3)10-14-18(24)22-20(26)23(19(14)25)13-7-5-12(21)6-8-13/h4-10H,1-3H3,(H,22,24,26) |
| InChIKey | WNYFKQZWVRDTND-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|