About N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine
N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine (PubChem CID 14200028) has the molecular formula C18H18N2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine.
Molecular Properties
| Compound Name | N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine |
| PubChem CID | 14200028 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine |
| SMILES | CC1(C)N=C(c2ccccc2)S/C1=N\Cc1ccccc1 |
| InChI | InChI=1S/C18H18N2S/c1-18(2)17(19-13-14-9-5-3-6-10-14)21-16(20-18)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3/b19-17- |
| InChIKey | RHWZTSSCOYQDDA-ZPHPHTNESA-N |
| XLogP | 4.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine?
The IUPAC name of N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine (CID 14200028) is N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine.
What is the SMILES notation for N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine?
The canonical SMILES for N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine is CC1(C)N=C(c2ccccc2)S/C1=N\Cc1ccccc1.
What is the InChIKey of N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine?
The InChIKey is RHWZTSSCOYQDDA-ZPHPHTNESA-N. The full InChI is InChI=1S/C18H18N2S/c1-18(2)17(19-13-14-9-5-3-6-10-14)21-16(20-18)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3/b19-17-.
What are the key properties of N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine?
N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine has a molecular weight of 294.42 g/mol, XLogP of 4.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4,4-dimethyl-2-phenyl-1,3-thiazol-5-imine is sourced from PubChem (CID 14200028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).