C21H34N2O5 — CID 142000338
pentane;propan-2-yl (2S)-2-[3-[formyl(hydroxy)amino]propanoylamino]-3-phenylpropanoate (PubChem CID 142000338) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is pentane;propan-2-yl (2S)-2-[3-[formyl(hydroxy)amino]propanoylamino]-3-phenylpropanoate.
| Compound Name | pentane;propan-2-yl (2S)-2-[3-[formyl(hydroxy)amino]propanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 142000338 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | pentane;propan-2-yl (2S)-2-[3-[formyl(hydroxy)amino]propanoylamino]-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)[C@H](Cc1ccccc1)NC(=O)CCN(O)C=O.CCCCC |
| InChI | InChI=1S/C16H22N2O5.C5H12/c1-12(2)23-16(21)14(10-13-6-4-3-5-7-13)17-15(20)8-9-18(22)11-19;1-3-5-4-2/h3-7,11-12,14,22H,8-10H2,1-2H3,(H,17,20);3-5H2,1-2H3/t14-;/m0./s1 |
| InChIKey | ANNJBEWUDPKBCX-UQKRIMTDSA-N |
| XLogP | 3.10 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|