C32H51NO2 — CID 142000571
[(17S)-4,4,10,11,13-pentamethyl-17-(5-methyl-4-methylidenehexyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-aminoacetate (PubChem CID 142000571) has the molecular formula C32H51NO2 and a molecular weight of 481.77 g/mol. Its IUPAC name is [(17S)-4,4,10,11,13-pentamethyl-17-(5-methyl-4-methylidenehexyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-aminoacetate.
| Compound Name | [(17S)-4,4,10,11,13-pentamethyl-17-(5-methyl-4-methylidenehexyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 142000571 |
| Molecular Formula | C32H51NO2 |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 481.39 |
| IUPAC Name | [(17S)-4,4,10,11,13-pentamethyl-17-(5-methyl-4-methylidenehexyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-aminoacetate |
| SMILES | C=C(CCC[C@H]1CC=C2C3=C(C(C)CC21C)C1(C)CCC(OC(=O)CN)C(C)(C)C1CC3)C(C)C |
| InChI | InChI=1S/C32H51NO2/c1-20(2)21(3)10-9-11-23-12-14-25-24-13-15-26-30(5,6)27(35-28(34)19-33)16-17-31(26,7)29(24)22(4)18-32(23,25)8/h14,20,22-23,26-27H,3,9-13,15-19,33H2,1-2,4-8H3/t22?,23-,26?,27?,31?,32?/m0/s1 |
| InChIKey | YIKGNAZRXKIQQZ-MSKQDNHGSA-N |
| XLogP | 7.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|