C21H29ClN3O+ — CID 142001235
[[2-[[4-[(3-chlorophenyl)methyl]piperidin-1-yl]methyl]-3-methylanilino]-hydroxymethyl]azanium (PubChem CID 142001235) has the molecular formula C21H29ClN3O+ and a molecular weight of 374.94 g/mol. Its IUPAC name is [[2-[[4-[(3-chlorophenyl)methyl]piperidin-1-yl]methyl]-3-methylanilino]-hydroxymethyl]azanium.
| Compound Name | [[2-[[4-[(3-chlorophenyl)methyl]piperidin-1-yl]methyl]-3-methylanilino]-hydroxymethyl]azanium |
|---|---|
| PubChem CID | 142001235 |
| Molecular Formula | C21H29ClN3O+ |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | [[2-[[4-[(3-chlorophenyl)methyl]piperidin-1-yl]methyl]-3-methylanilino]-hydroxymethyl]azanium |
| SMILES | Cc1cccc(NC([NH3+])O)c1CN1CCC(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H28ClN3O/c1-15-4-2-7-20(24-21(23)26)19(15)14-25-10-8-16(9-11-25)12-17-5-3-6-18(22)13-17/h2-7,13,16,21,24,26H,8-12,14,23H2,1H3/p+1 |
| InChIKey | DILUCPIFQONSES-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 63.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|