4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen

C13H22N2 — CID 142001824

IUPAC4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen
SMILESCC1=C=CN(CCC2CCCCN2)C=C1.[H][H]
InChIInChI=1S/C13H20N2.H2/c1-12-5-9-15(10-6-12)11-7-13-4-2-3-8-14-13;/h5,9-10,13-14H,2-4,7-8,11H2,1H3;1H
InChIKeyOOLQDBOURBQDIM-UHFFFAOYSA-N
MW206.33 g/mol
LogP2.65
Rot. Bonds3

About 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen

4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen (PubChem CID 142001824) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen.

Molecular Properties

Compound Name4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen
PubChem CID142001824
Molecular FormulaC13H22N2
Molecular Weight206.33 g/mol
Exact Mass206.18
IUPAC Name4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen
SMILESCC1=C=CN(CCC2CCCCN2)C=C1.[H][H]
InChIInChI=1S/C13H20N2.H2/c1-12-5-9-15(10-6-12)11-7-13-4-2-3-8-14-13;/h5,9-10,13-14H,2-4,7-8,11H2,1H3;1H
InChIKeyOOLQDBOURBQDIM-UHFFFAOYSA-N
XLogP2.65
TPSA15.27 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.33
LogP ≤ 52.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen?
The IUPAC name of 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen (CID 142001824) is 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen.
What is the SMILES notation for 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen?
The canonical SMILES for 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen is CC1=C=CN(CCC2CCCCN2)C=C1.[H][H].
What is the InChIKey of 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen?
The InChIKey is OOLQDBOURBQDIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2.H2/c1-12-5-9-15(10-6-12)11-7-13-4-2-3-8-14-13;/h5,9-10,13-14H,2-4,7-8,11H2,1H3;1H.
What are the key properties of 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen?
4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen has a molecular weight of 206.33 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(2-piperidin-2-ylethyl)pyridine;molecular hydrogen is sourced from PubChem (CID 142001824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).