About 1-methylpiperidine;1,2,4,5-tetramethylimidazole
1-methylpiperidine;1,2,4,5-tetramethylimidazole (PubChem CID 142002104) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-methylpiperidine;1,2,4,5-tetramethylimidazole.
Molecular Properties
| Compound Name | 1-methylpiperidine;1,2,4,5-tetramethylimidazole |
| PubChem CID | 142002104 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 1-methylpiperidine;1,2,4,5-tetramethylimidazole |
| SMILES | CN1CCCCC1.Cc1nc(C)n(C)c1C |
| InChI | InChI=1S/C7H12N2.C6H13N/c1-5-6(2)9(4)7(3)8-5;1-7-5-3-2-4-6-7/h1-4H3;2-6H2,1H3 |
| InChIKey | YYIIIERFRYJFGR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylpiperidine;1,2,4,5-tetramethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidine;1,2,4,5-tetramethylimidazole?
The IUPAC name of 1-methylpiperidine;1,2,4,5-tetramethylimidazole (CID 142002104) is 1-methylpiperidine;1,2,4,5-tetramethylimidazole.
What is the SMILES notation for 1-methylpiperidine;1,2,4,5-tetramethylimidazole?
The canonical SMILES for 1-methylpiperidine;1,2,4,5-tetramethylimidazole is CN1CCCCC1.Cc1nc(C)n(C)c1C.
What is the InChIKey of 1-methylpiperidine;1,2,4,5-tetramethylimidazole?
The InChIKey is YYIIIERFRYJFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C6H13N/c1-5-6(2)9(4)7(3)8-5;1-7-5-3-2-4-6-7/h1-4H3;2-6H2,1H3.
What are the key properties of 1-methylpiperidine;1,2,4,5-tetramethylimidazole?
1-methylpiperidine;1,2,4,5-tetramethylimidazole has a molecular weight of 223.36 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidine;1,2,4,5-tetramethylimidazole is sourced from PubChem (CID 142002104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).