About butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine
butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine (PubChem CID 142002461) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine.
Molecular Properties
| Compound Name | butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine |
| PubChem CID | 142002461 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine |
| SMILES | C/C=C(\N=C\C)C(C)C.CCCCN |
| InChI | InChI=1S/C8H15N.C4H11N/c1-5-8(7(3)4)9-6-2;1-2-3-4-5/h5-7H,1-4H3;2-5H2,1H3/b8-5-,9-6+; |
| InChIKey | GUZGCLKNBBPMIH-BJHRKZFFSA-N |
| XLogP | 3.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine?
The IUPAC name of butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine (CID 142002461) is butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine.
What is the SMILES notation for butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine?
The canonical SMILES for butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine is C/C=C(\N=C\C)C(C)C.CCCCN.
What is the InChIKey of butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine?
The InChIKey is GUZGCLKNBBPMIH-BJHRKZFFSA-N. The full InChI is InChI=1S/C8H15N.C4H11N/c1-5-8(7(3)4)9-6-2;1-2-3-4-5/h5-7H,1-4H3;2-5H2,1H3/b8-5-,9-6+;.
What are the key properties of butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine?
butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine has a molecular weight of 198.35 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;N-[(Z)-4-methylpent-2-en-3-yl]ethanimine is sourced from PubChem (CID 142002461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).