About ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine
ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine (PubChem CID 142002778) has the molecular formula C17H35N
and a molecular weight of 253.47 g/mol. Its IUPAC name is ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine.
Molecular Properties
| Compound Name | ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine |
| PubChem CID | 142002778 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine |
| SMILES | C.C/C=N/C=C(\C)CCC.CCC1CCCCC1 |
| InChI | InChI=1S/C8H15N.C8H16.CH4/c1-4-6-8(3)7-9-5-2;1-2-8-6-4-3-5-7-8;/h5,7H,4,6H2,1-3H3;8H,2-7H2,1H3;1H4/b8-7+,9-5+;; |
| InChIKey | GITJWPRIKPSXTA-JWCQZTDMSA-N |
| XLogP | 6.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine?
The IUPAC name of ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine (CID 142002778) is ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine.
What is the SMILES notation for ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine?
The canonical SMILES for ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine is C.C/C=N/C=C(\C)CCC.CCC1CCCCC1.
What is the InChIKey of ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine?
The InChIKey is GITJWPRIKPSXTA-JWCQZTDMSA-N. The full InChI is InChI=1S/C8H15N.C8H16.CH4/c1-4-6-8(3)7-9-5-2;1-2-8-6-4-3-5-7-8;/h5,7H,4,6H2,1-3H3;8H,2-7H2,1H3;1H4/b8-7+,9-5+;;.
What are the key properties of ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine?
ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine has a molecular weight of 253.47 g/mol, XLogP of 6.39, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylcyclohexane;methane;N-[(E)-2-methylpent-1-enyl]ethanimine is sourced from PubChem (CID 142002778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).