C31H42BrN7O3 — CID 142002920
N-[3-(2-aminoimidazol-1-yl)propyl]formamide;tert-butyl 4-(6-bromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate (PubChem CID 142002920) has the molecular formula C31H42BrN7O3 and a molecular weight of 640.63 g/mol. Its IUPAC name is N-[3-(2-aminoimidazol-1-yl)propyl]formamide;tert-butyl 4-(6-bromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate.
| Compound Name | N-[3-(2-aminoimidazol-1-yl)propyl]formamide;tert-butyl 4-(6-bromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142002920 |
| Molecular Formula | C31H42BrN7O3 |
| Molecular Weight | 640.63 g/mol |
| Exact Mass | 639.25 |
| IUPAC Name | N-[3-(2-aminoimidazol-1-yl)propyl]formamide;tert-butyl 4-(6-bromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate |
| SMILES | Cc1ccc2c(c1)CCc1cc(Br)cnc1C2N1CCN(C(=O)OC(C)(C)C)CC1.Nc1nccn1CCCNC=O |
| InChI | InChI=1S/C24H30BrN3O2.C7H12N4O/c1-16-5-8-20-17(13-16)6-7-18-14-19(25)15-26-21(18)22(20)27-9-11-28(12-10-27)23(29)30-24(2,3)4;8-7-10-3-5-11(7)4-1-2-9-6-12/h5,8,13-15,22H,6-7,9-12H2,1-4H3;3,5-6H,1-2,4H2,(H2,8,10)(H,9,12) |
| InChIKey | BODMPCXRFYABPW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|