About cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate
cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate (PubChem CID 142003345) has the molecular formula C18H26N2O2
and a molecular weight of 302.42 g/mol. Its IUPAC name is cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate.
Molecular Properties
| Compound Name | cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate |
| PubChem CID | 142003345 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate |
| SMILES | NC1CCCCC1.O.[H]/N=C/c1ccc(CO)c2ccccc12 |
| InChI | InChI=1S/C12H11NO.C6H13N.H2O/c13-7-9-5-6-10(8-14)12-4-2-1-3-11(9)12;7-6-4-2-1-3-5-6;/h1-7,13-14H,8H2;6H,1-5,7H2;1H2/b13-7+;; |
| InChIKey | MSRSYYFYAMBIEU-JOZOFPPJSA-N |
| XLogP | 2.78 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate?
The IUPAC name of cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate (CID 142003345) is cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate.
What is the SMILES notation for cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate?
The canonical SMILES for cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate is NC1CCCCC1.O.[H]/N=C/c1ccc(CO)c2ccccc12.
What is the InChIKey of cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate?
The InChIKey is MSRSYYFYAMBIEU-JOZOFPPJSA-N. The full InChI is InChI=1S/C12H11NO.C6H13N.H2O/c13-7-9-5-6-10(8-14)12-4-2-1-3-11(9)12;7-6-4-2-1-3-5-6;/h1-7,13-14H,8H2;6H,1-5,7H2;1H2/b13-7+;;.
What are the key properties of cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate?
cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate has a molecular weight of 302.42 g/mol, XLogP of 2.78, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;(4-methanimidoylnaphthalen-1-yl)methanol;hydrate is sourced from PubChem (CID 142003345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).