C16H13N3O3 — CID 142003500
2-(4-cyanophenoxy)-N-(3-hydroxy-4-methanimidoylphenyl)acetamide (PubChem CID 142003500) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-(3-hydroxy-4-methanimidoylphenyl)acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-(3-hydroxy-4-methanimidoylphenyl)acetamide |
|---|---|
| PubChem CID | 142003500 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-(3-hydroxy-4-methanimidoylphenyl)acetamide |
| SMILES | [H]/N=C/c1ccc(NC(=O)COc2ccc(C#N)cc2)cc1O |
| InChI | InChI=1S/C16H13N3O3/c17-8-11-1-5-14(6-2-11)22-10-16(21)19-13-4-3-12(9-18)15(20)7-13/h1-7,9,18,20H,10H2,(H,19,21)/b18-9+ |
| InChIKey | RGKJIHSMFXUBAJ-GIJQJNRQSA-N |
| XLogP | 2.28 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|