About [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide
[1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide (PubChem CID 142003539) has the molecular formula C26H27N3O2
and a molecular weight of 413.52 g/mol. Its IUPAC name is [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide.
Molecular Properties
| Compound Name | [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide |
| PubChem CID | 142003539 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1O.[H]/N=C/c1cccc2c1ccn2Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C18H18N2.C8H9NO2/c1-2-14-6-8-15(9-7-14)13-20-11-10-17-16(12-19)4-3-5-18(17)20;1-5-4-6(8(9)11)2-3-7(5)10/h3-12,19H,2,13H2,1H3;2-4,10H,1H3,(H2,9,11)/b19-12+; |
| InChIKey | UTAMGEDTZVUHCQ-NNTHFVATSA-N |
| XLogP | 5.05 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide?
The IUPAC name of [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide (CID 142003539) is [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide.
What is the SMILES notation for [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide?
The canonical SMILES for [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide is Cc1cc(C(N)=O)ccc1O.[H]/N=C/c1cccc2c1ccn2Cc1ccc(CC)cc1.
What is the InChIKey of [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide?
The InChIKey is UTAMGEDTZVUHCQ-NNTHFVATSA-N. The full InChI is InChI=1S/C18H18N2.C8H9NO2/c1-2-14-6-8-15(9-7-14)13-20-11-10-17-16(12-19)4-3-5-18(17)20;1-5-4-6(8(9)11)2-3-7(5)10/h3-12,19H,2,13H2,1H3;2-4,10H,1H3,(H2,9,11)/b19-12+;.
What are the key properties of [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide?
[1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide has a molecular weight of 413.52 g/mol, XLogP of 5.05, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-ethylphenyl)methyl]indol-4-yl]methanimine;4-hydroxy-3-methylbenzamide is sourced from PubChem (CID 142003539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).