C17H22 — CID 142003731
(6Z,7Z)-3,3-dimethyl-6-[(E)-pent-3-enylidene]-7-prop-2-ynylidenecycloheptene (PubChem CID 142003731) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is (6Z,7Z)-3,3-dimethyl-6-[(E)-pent-3-enylidene]-7-prop-2-ynylidenecycloheptene.
| Compound Name | (6Z,7Z)-3,3-dimethyl-6-[(E)-pent-3-enylidene]-7-prop-2-ynylidenecycloheptene |
|---|---|
| PubChem CID | 142003731 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (6Z,7Z)-3,3-dimethyl-6-[(E)-pent-3-enylidene]-7-prop-2-ynylidenecycloheptene |
| SMILES | C#C/C=C1/C=CC(C)(C)CC/C1=C/C/C=C/C |
| InChI | InChI=1S/C17H22/c1-5-7-8-10-16-12-14-17(3,4)13-11-15(16)9-6-2/h2,5,7,9-11,13H,8,12,14H2,1,3-4H3/b7-5+,15-9-,16-10- |
| InChIKey | ARRLQQKZYOTXOE-KBQGITIBSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|