About ethane;ethylbenzene;2-propylpentanal
ethane;ethylbenzene;2-propylpentanal (PubChem CID 142003951) has the molecular formula C18H32O
and a molecular weight of 264.45 g/mol. Its IUPAC name is ethane;ethylbenzene;2-propylpentanal.
Molecular Properties
| Compound Name | ethane;ethylbenzene;2-propylpentanal |
| PubChem CID | 142003951 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | ethane;ethylbenzene;2-propylpentanal |
| SMILES | CC.CCCC(C=O)CCC.CCc1ccccc1 |
| InChI | InChI=1S/C8H16O.C8H10.C2H6/c1-3-5-8(7-9)6-4-2;1-2-8-6-4-3-5-7-8;1-2/h7-8H,3-6H2,1-2H3;3-7H,2H2,1H3;1-2H3 |
| InChIKey | CIELRCYWIWWXPQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethylbenzene;2-propylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethylbenzene;2-propylpentanal?
The IUPAC name of ethane;ethylbenzene;2-propylpentanal (CID 142003951) is ethane;ethylbenzene;2-propylpentanal.
What is the SMILES notation for ethane;ethylbenzene;2-propylpentanal?
The canonical SMILES for ethane;ethylbenzene;2-propylpentanal is CC.CCCC(C=O)CCC.CCc1ccccc1.
What is the InChIKey of ethane;ethylbenzene;2-propylpentanal?
The InChIKey is CIELRCYWIWWXPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C8H10.C2H6/c1-3-5-8(7-9)6-4-2;1-2-8-6-4-3-5-7-8;1-2/h7-8H,3-6H2,1-2H3;3-7H,2H2,1H3;1-2H3.
What are the key properties of ethane;ethylbenzene;2-propylpentanal?
ethane;ethylbenzene;2-propylpentanal has a molecular weight of 264.45 g/mol, XLogP of 5.68, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethylbenzene;2-propylpentanal is sourced from PubChem (CID 142003951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).