C17H38N2O — CID 142004178
2-(2,2-dimethylbutyl)-3,3,5-trimethylhexanehydrazide;ethane (PubChem CID 142004178) has the molecular formula C17H38N2O and a molecular weight of 286.50 g/mol. Its IUPAC name is 2-(2,2-dimethylbutyl)-3,3,5-trimethylhexanehydrazide;ethane.
| Compound Name | 2-(2,2-dimethylbutyl)-3,3,5-trimethylhexanehydrazide;ethane |
|---|---|
| PubChem CID | 142004178 |
| Molecular Formula | C17H38N2O |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.30 |
| IUPAC Name | 2-(2,2-dimethylbutyl)-3,3,5-trimethylhexanehydrazide;ethane |
| SMILES | CC.CCC(C)(C)CC(C(=O)NN)C(C)(C)CC(C)C |
| InChI | InChI=1S/C15H32N2O.C2H6/c1-8-14(4,5)10-12(13(18)17-16)15(6,7)9-11(2)3;1-2/h11-12H,8-10,16H2,1-7H3,(H,17,18);1-2H3 |
| InChIKey | MXMJASATPMKOPA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|